AB46951
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 98% | in stock | $20.00 | $14.00 | - + | |
100g | 98% | in stock | $58.00 | $40.00 | - + | |
500g | 98% | in stock | $279.00 | $195.00 | - + | |
1kg | 98% | in stock | $441.00 | $309.00 | - + | |
5kg | 98% | in stock | $1,686.00 | $1,180.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46951 |
Chemical Name: | Pullulan |
CAS Number: | 9057-02-7 |
Molecular Formula: | C23H42O16 |
Molecular Weight: | 574.57 |
MDL Number: | MFCD00081940 |
SMILES: | COCC1OC(COCC2C(CO)OC(C(C2O)O)COCC2C(CO)OC(C(C2O)O)O)C(C(C1O)O)O |
Pullulan is a versatile polysaccharide that finds extensive application in chemical synthesis. In the realm of organic chemistry, Pullulan serves as a valuable crosslinking agent for the formation of hydrogels. Its ability to form stable matrices makes it a popular choice for encapsulating active compounds in drug delivery systems. Additionally, Pullulan can be chemically modified to introduce specific functional groups, thereby enabling tailored interactions in various chemical reactions. Its biocompatibility and biodegradability also make it a suitable candidate for sustainable materials in green chemistry initiatives. Overall, Pullulan plays a pivotal role in enhancing the efficiency and versatility of chemical synthesis strategies.