AB75067
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $12.00 | $8.00 | - + | |
1g | 98% | in stock | $25.00 | $17.00 | - + | |
5g | 98% | in stock | $76.00 | $53.00 | - + | |
10g | 98% | in stock | $116.00 | $81.00 | - + | |
25g | 98% | in stock | $253.00 | $177.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB75067 |
Chemical Name: | (S)-N-Boc-allylglycine |
CAS Number: | 90600-20-7 |
Molecular Formula: | C10H17NO4 |
Molecular Weight: | 215.2463 |
MDL Number: | MFCD01320851 |
SMILES: | C=CC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 255 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 1.7 |
(S)-2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid, also known as $name$, is a key intermediate in chemical synthesis with versatile applications. This compound plays a crucial role in organic chemistry as a building block for the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. One of the primary uses of (S)-2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid is in the preparation of peptide derivatives. Peptides are essential molecules in biological systems and serve as the building blocks of proteins. By incorporating (S)-2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid into the peptide synthesis process, chemists can control the stereochemistry and functionality of the final peptide product. Additionally, this compound is utilized in the synthesis of chiral intermediates and complex natural products. Its unique structure and reactivity make it a valuable starting material for creating asymmetrical compounds with specific biological activities. Researchers can use (S)-2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid to access a wide range of enantiomerically pure substances with tailored properties.Overall, (S)-2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid is an essential component in the toolbox of synthetic chemists, enabling the construction of intricate molecules with precise control over stereochemistry and functionality. Its versatility in chemical synthesis makes it a valuable asset in the development of new drugs, materials, and bioactive compounds.