AB42981
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 98% | in stock | $13.00 | $9.00 | - + | |
100g | 98% | in stock | $35.00 | $24.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42981 |
Chemical Name: | (S)-4-Benzyl-2-oxazolidinone |
CAS Number: | 90719-32-7 |
Molecular Formula: | C10H11NO2 |
Molecular Weight: | 177.1998 |
MDL Number: | MFCD00064496 |
SMILES: | O=C1OC[C@@H](N1)Cc1ccccc1 |
Complexity: | 187 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.7 |
(S)-4-Benzyl-2-oxazolidinone is a versatile compound widely utilized in chemical synthesis as a chiral auxiliary reagent. This compound serves as a useful tool in asymmetric synthesis by facilitating the creation of enantiomerically enriched products. By exploiting the chirality of (S)-4-Benzyl-2-oxazolidinone, chemists can selectively enhance the stereochemical outcomes of various reactions. Its application extends to the synthesis of pharmaceuticals, natural products, and agrochemicals where precise control over stereochemistry is crucial for biological activity and effectiveness. The utilization of (S)-4-Benzyl-2-oxazolidinone in chemical transformations enables the synthesis of complex molecules with high levels of stereochemical purity, making it a valuable asset in the toolkit of synthetic chemists.
Nature chemistry 20120201
The Journal of organic chemistry 20020308