AB52643
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98+% | in stock | $82.00 | $57.00 | - + | |
2mg | 98+% | in stock | $146.00 | $103.00 | - + | |
5mg | 98+% | in stock | $218.00 | $153.00 | - + | |
100mg | 98% by HPLC | in stock | $3,990.00 | $2,793.00 | - + | |
500mg | 98% by HPLC | in stock | $12,760.00 | $8,932.00 | - + | |
1000mg | 98% by HPLC | in stock | $20,386.00 | $14,270.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52643 |
Chemical Name: | MK-2461 |
CAS Number: | 917879-39-1 |
Molecular Formula: | C24H25N5O5S |
Molecular Weight: | 495.5508 |
MDL Number: | MFCD11977739 |
SMILES: | Cn1ncc(c1)c1cnc2c(c1)c(=O)c1cc(ccc1cc2)NS(=O)(=O)N(C[C@@H]1COCCO1)C |
Complexity: | 895 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 1.2 |
Journal of medicinal chemistry 20110623
European journal of medicinal chemistry 20110601
Cancer research 20100215