AW28201
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $325.00 | $228.00 | - + | |
100mg | 95% | 1 week | $448.00 | $314.00 | - + | |
250mg | 95% | 1 week | $603.00 | $422.00 | - + | |
500mg | 95% | 1 week | $1,064.00 | $745.00 | - + | |
1g | 95% | 1 week | $1,357.00 | $950.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AW28201 |
Chemical Name: | 2-(3-nitrophenyl)cyclopropane-1-carboxylic acid, Mixture of diastereomers |
CAS Number: | 91880-89-6 |
Molecular Formula: | C10H9NO4 |
Molecular Weight: | 207.1828 |
MDL Number: | MFCD12068254 |
SMILES: | OC(=O)C1CC1c1cccc(c1)[N+](=O)[O-] |