AX46894
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $22.00 | $16.00 | - + | |
5mg | 95% | in stock | $56.00 | $39.00 | - + | |
10mg | 95% | in stock | $77.00 | $54.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX46894 |
Chemical Name: | As1517499 |
CAS Number: | 919486-40-1 |
Molecular Formula: | C20H20ClN5O2 |
Molecular Weight: | 397.8581 |
MDL Number: | MFCD24038757 |
SMILES: | NC(=O)c1cnc(nc1NCc1ccccc1)NCCc1ccc(c(c1)Cl)O |
Complexity: | 491 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 8 |
XLogP3: | 4 |
Molecules (Basel, Switzerland) 20140808
Pharmacological research 20100201
American journal of respiratory cell and molecular biology 20091101
Bioorganic & medicinal chemistry 20080701
Bioorganic & medicinal chemistry 20070115
Infection and immunity 19751201