AX10264
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $19.00 | $13.00 | - + | |
1g | 97% | in stock | $39.00 | $28.00 | - + | |
5g | 97% | in stock | $90.00 | $63.00 | - + | |
10g | 97% | in stock | $161.00 | $113.00 | - + | |
25g | 97% | in stock | $336.00 | $235.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX10264 |
Chemical Name: | N1,N2-Bis(thiophen-2-ylmethyl)oxalamide |
CAS Number: | 920366-91-2 |
Molecular Formula: | C12H12N2O2S2 |
Molecular Weight: | 280.3659 |
MDL Number: | MFCD08351678 |
SMILES: | O=C(C(=O)NCc1cccs1)NCc1cccs1 |
Ethanediamide, N1, N2-bis(2-thienylmethyl)-, is a versatile compound widely utilized in chemical synthesis processes. Its unique structure and properties make it an ideal reagent for various reactions in organic chemistry. This compound is often employed as a key building block in the preparation of complex organic molecules due to its ability to participate in a range of useful transformations. In chemical synthesis, Ethanediamide, N1, N2-bis(2-thienylmethyl)- can serve as a valuable intermediate for the construction of heterocyclic compounds, pharmaceuticals, and materials with tailored properties. Its presence in a reaction mixture can facilitate the formation of specific bonds and functional groups, leading to the synthesis of novel compounds with potential applications in various industries. By incorporating Ethanediamide, N1, N2-bis(2-thienylmethyl)- into synthetic pathways, chemists can efficiently access a diverse array of organic molecules with desired structures and properties.