AC82670
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | ≥95% (mixture of cis and trans) | in stock | $42.00 | $29.00 | - + | |
10mg | 98%(HPLC) | in stock | $59.00 | $41.00 | - + | |
25mg | 98%(HPLC) | in stock | $120.00 | $84.00 | - + | |
50mg | ≥95% (mixture of cis and trans) | in stock | $218.00 | $153.00 | - + | |
100mg | 98%(HPLC) | in stock | $245.00 | $171.00 | - + | |
1g | 98%(HPLC) | in stock | $695.00 | $487.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC82670 |
Chemical Name: | (6S,7R)-7-((R)-2-Amino-2-(4-hydroxyphenyl)acetamido)-8-oxo-3-((E)-prop-1-en-1-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
CAS Number: | 92665-29-7 |
Molecular Formula: | C18H19N3O5S |
Molecular Weight: | 389.4256 |
MDL Number: | MFCD00911719 |
SMILES: | C/C=C/C1=C(C(=O)O)N2[C@H](SC1)[C@@H](C2=O)NC(=O)[C@@H](c1ccc(cc1)O)N |