AH84298
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $10.00 | $7.00 | - + | |
5mg | 98% | in stock | $23.00 | $17.00 | - + | |
10mg | 98% | in stock | $35.00 | $25.00 | - + | |
25mg | 98% | in stock | $59.00 | $41.00 | - + | |
50mg | 98% | in stock | $93.00 | $65.00 | - + | |
100mg | 98% | in stock | $149.00 | $104.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH84298 |
Chemical Name: | Pimelic Diphenylamide 106 |
CAS Number: | 937039-45-7 |
Molecular Formula: | C20H25N3O2 |
Molecular Weight: | 339.4314 |
MDL Number: | MFCD17010287 |
SMILES: | O=C(Nc1ccc(cc1)C)CCCCCC(=O)Nc1ccccc1N |
Complexity: | 419 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 8 |
XLogP3: | 2.8 |
Chemistry & biology 20090925
The Journal of biological chemistry 20081219