AB59106
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $7.00 | $5.00 | - + | |
10g | 97% | in stock | $10.00 | $7.00 | - + | |
20g | 97% | in stock | $12.00 | $9.00 | - + | |
25g | 97% | in stock | $13.00 | $10.00 | - + | |
100g | 97% | in stock | $46.00 | $32.00 | - + | |
500g | 97% | in stock | $220.00 | $154.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB59106 |
Chemical Name: | 2-(4-Methylphenyl)propanoic acid |
CAS Number: | 938-94-3 |
Molecular Formula: | C10H12O2 |
Molecular Weight: | 164.2011 |
MDL Number: | MFCD01111378 |
SMILES: | C[C@H](c1ccc(cc1)C)C(=O)O |
Complexity: | 157 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 2.3 |
Journal of medicinal chemistry 20050630