AI01162
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $16.00 | $11.00 | - + | |
5g | 98% | in stock | $23.00 | $16.00 | - + | |
25g | 98% | in stock | $29.00 | $20.00 | - + | |
100g | 98% | in stock | $44.00 | $31.00 | - + | |
500g | 98% | in stock | $211.00 | $148.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI01162 |
Chemical Name: | 5-Nitro-1H-1,3-benzodiazole |
CAS Number: | 94-52-0 |
Molecular Formula: | C7H5N3O2 |
Molecular Weight: | 163.1335 |
MDL Number: | MFCD00005604 |
SMILES: | O=N(=O)c1ccc2c(c1)nc[nH]2 |
Complexity: | 192 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.6 |
The 1H-Benzimidazole, 6-nitro- compound is a versatile building block in chemical synthesis, commonly utilized for its unique properties and reactivity. With its nitro group at the 6th position on the benzimidazole ring, this compound serves as a valuable precursor in the development of various pharmaceuticals, agrochemicals, and materials.In organic synthesis, 1H-Benzimidazole, 6-nitro- can be employed as a key intermediate in the preparation of a wide range of bioactive molecules. The nitro group can undergo reduction to an amino group, allowing for further functionalization of the molecule. Additionally, this compound can participate in nucleophilic substitution reactions, leading to the formation of diverse chemical structures with varied functionalities.Moreover, the presence of the benzimidazole scaffold confers desirable properties such as bioavailability and interaction with biological targets. This makes 1H-Benzimidazole, 6-nitro- an attractive starting material for the design and synthesis of potential drug candidates targeting diseases such as cancer, infectious diseases, and neurological disorders.Overall, the application of 1H-Benzimidazole, 6-nitro- in chemical synthesis offers a promising avenue for the development of novel compounds with therapeutic and industrial relevance.
Bioorganic & medicinal chemistry 20120215
Acta crystallographica. Section E, Structure reports online 20100701
Bioorganic & medicinal chemistry 20070515
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501
Biochemistry 20030909
The Journal of organic chemistry 20030711