AC95249
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $16.00 | $11.00 | - + | |
1g | 95% | in stock | $20.00 | $14.00 | - + | |
5g | 95% | in stock | $25.00 | $18.00 | - + | |
10g | 95% | in stock | $29.00 | $21.00 | - + | |
25g | 95% | in stock | $52.00 | $37.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC95249 |
Chemical Name: | 2-Bromo-5-nitrobenzoic acid |
CAS Number: | 943-14-6 |
Molecular Formula: | C7H4BrNO4 |
Molecular Weight: | 246.01496 |
MDL Number: | MFCD00134558 |
SMILES: | [O-][N+](=O)c1ccc(c(c1)C(=O)O)Br |
NSC Number: | 52211 |
Complexity: | 227 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.1 |
Journal of the American Chemical Society 20080305