AB79887
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 97% | in stock | $29.00 | $20.00 | - + | |
5g | 97% | in stock | $63.00 | $45.00 | - + | |
10g | 97% | in stock | $103.00 | $73.00 | - + | |
25g | 97% | in stock | $257.00 | $180.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79887 |
Chemical Name: | Trans-4-tert-butylcyclohexanecarboxylic acid |
CAS Number: | 943-29-3 |
Molecular Formula: | C11H20O2 |
Molecular Weight: | 184.2753 |
MDL Number: | MFCD00466237 |
SMILES: | OC(=O)[C@@H]1CC[C@H](CC1)C(C)(C)C |
The trans-4-tert-Butylcyclohexanoic acid is a versatile compound widely utilized in chemical synthesis. Its unique molecular structure and functional groups make it a valuable building block for the creation of various chemicals and materials. In organic chemistry, trans-4-tert-Butylcyclohexanoic acid is frequently employed as a precursor in the synthesis of pharmaceuticals, agrochemicals, and advanced polymers. Its reactivity and compatibility with a range of reaction conditions make it an ideal choice for forming complex organic molecules with specific stereochemical arrangements. Additionally, this compound can serve as a key intermediate in the production of specialty chemicals used in industries such as cosmetics, flavors, and fragrance. By incorporating trans-4-tert-Butylcyclohexanoic acid into chemical reactions, researchers and chemists can access a diverse array of molecular structures and functionalized compounds, thereby enabling the development of innovative products with tailored properties and performance characteristics.