logo
Home  > Fmoc-N-methyl-L-cysteine(Trt)

AI69061

944797-51-7 | Fmoc-N-methyl-L-cysteine(Trt)

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $28.00 $20.00 -   +
250mg 95% in stock $34.00 $24.00 -   +
1g 95% in stock $63.00 $45.00 -   +
5g 95% in stock $282.00 $198.00 -   +
25g 95% in stock $1,283.00 $898.00 -   +
100g 95% in stock $3,867.00 $2,707.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AI69061
Chemical Name: Fmoc-N-methyl-L-cysteine(Trt)
CAS Number: 944797-51-7
Molecular Formula: C38H33NO4S
Molecular Weight: 599.7379
MDL Number: MFCD11973909
SMILES: OC(=O)[C@@H](N(C(=O)OCC1c2ccccc2-c2c1cccc2)C)CSC(c1ccccc1)(c1ccccc1)c1ccccc1

 

Upstream Synthesis Route
  • FMoc-N-Me-Cys(Trt)-OH is a valuable building block in chemical synthesis, specifically in peptide synthesis. This compound serves as a protected form of N-methyl cysteine, providing a versatile starting material for the creation of complex peptides and proteins.By utilizing FMoc-N-Me-Cys(Trt)-OH in peptide synthesis, chemists can introduce N-methyl cysteine residues into the peptide chain while protecting the amino and thiol groups. This protection strategy allows for selective deprotection and manipulation of specific regions of the peptide, enabling the stepwise assembly of the desired sequence with high precision and control.The Trityl (Trt) protecting group on the cysteine thiol ensures its stability during the synthesis process, preventing undesired reactions and side products. This protection strategy is crucial for maintaining the integrity of the peptide sequence and facilitating the efficient formation of peptide bonds between the N-methyl cysteine residue and neighboring amino acids.Overall, FMoc-N-Me-Cys(Trt)-OH plays a crucial role in the synthesis of peptides with unique structural and functional properties, making it an essential tool for chemists in the field of peptide chemistry and drug development.
FEATURED PRODUCTS