AI63215
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
2mg | 98+% | in stock | $27.00 | $19.00 | - + | |
5mg | 98+% | in stock | $39.00 | $28.00 | - + | |
25mg | 98+% | in stock | $96.00 | $68.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI63215 |
Chemical Name: | Decernotinib |
CAS Number: | 944842-54-0 |
Molecular Formula: | C18H19F3N6O |
Molecular Weight: | 392.3783 |
MDL Number: | MFCD27987896 |
SMILES: | CC[C@](C(=O)NCC(F)(F)F)(Nc1ccnc(n1)c1c[nH]c2c1cccn2)C |
Complexity: | 548 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 3.1 |
Journal of medicinal chemistry 20140626