AI65488
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $10.00 | $7.00 | - + | |
1g | 97% | in stock | $28.00 | $20.00 | - + | |
5g | 97% | in stock | $90.00 | $63.00 | - + | |
10g | 97% | in stock | $146.00 | $103.00 | - + | |
25g | 97% | in stock | $277.00 | $194.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI65488 |
Chemical Name: | 2-Deoxy-2-fluoro-alpha-d-arabinofuranosyl bromide 3,5-dibenzoate |
CAS Number: | 97614-44-3 |
Molecular Formula: | C19H16BrFO5 |
Molecular Weight: | 423.2297 |
MDL Number: | MFCD15144963 |
SMILES: | F[C@@H]1[C@@H](Br)O[C@@H]([C@H]1OC(=O)c1ccccc1)COC(=O)c1ccccc1 |
Complexity: | 490 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 7 |
XLogP3: | 4.4 |
Organic & biomolecular chemistry 20080207
Organic & biomolecular chemistry 20041007
The Journal of organic chemistry 20030711
Nucleosides, nucleotides & nucleic acids 20030101