AB51807
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $8.00 | $6.00 | - + | |
250mg | 95% | in stock | $17.00 | $12.00 | - + | |
1g | 95% | in stock | $43.00 | $30.00 | - + | |
5g | 95% | in stock | $159.00 | $111.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB51807 |
Chemical Name: | 8-Methyl-8-azabicyclo[3.2.1]octan-3-amine |
CAS Number: | 98998-25-5 |
Molecular Formula: | C8H16N2 |
Molecular Weight: | 140.2260 |
MDL Number: | MFCD00210699 |
SMILES: | NC1C[C@@H]2CC[C@H](C1)N2C |
NSC Number: | 13185 |
Complexity: | 121 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Undefined Atom Stereocenter Count: | 2 |
XLogP3: | 0.5 |
PloS one 20110101
Organic & biomolecular chemistry 20090707
The Journal of pharmacology and experimental therapeutics 20040501
Organic & biomolecular chemistry 20040207
Journal of medicinal chemistry 20011206