AB47097
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $8.00 | $5.00 | - + | |
5g | 97% | in stock | $12.00 | $8.00 | - + | |
10g | 97% | in stock | $15.00 | $10.00 | - + | |
25g | 97% | in stock | $28.00 | $19.00 | - + | |
100g | 97% | in stock | $99.00 | $69.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB47097 |
Chemical Name: | Tetrabenzyl diphosphate |
CAS Number: | 990-91-0 |
Molecular Formula: | C28H28O7P2 |
Molecular Weight: | 538.4652 |
MDL Number: | MFCD00051941 |
SMILES: | O=P(OP(=O)(OCc1ccccc1)OCc1ccccc1)(OCc1ccccc1)OCc1ccccc1 |
Complexity: | 612 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 37 |
Hydrogen Bond Acceptor Count: | 7 |
Rotatable Bond Count: | 14 |
XLogP3: | 4.9 |
Journal of medicinal chemistry 20120308
Journal of medicinal chemistry 20120308
Sensors (Basel, Switzerland) 20090101
Carbohydrate research 20080721
Perspectives in medicinal chemistry 20070101