AA00242
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $6.00 | $4.00 | - + | |
250mg | 98% | in stock | $7.00 | $5.00 | - + | |
1g | 95% | in stock | $19.00 | $14.00 | - + | |
5g | 95% | in stock | $74.00 | $52.00 | - + | |
10g | 95% | in stock | $135.00 | $95.00 | - + | |
25g | 95% | in stock | $198.00 | $139.00 | - + | |
100g | 95% | in stock | $700.00 | $490.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00242 |
Chemical Name: | 3-Fluoro-2-nitrobenzoic acid |
CAS Number: | 1000339-51-4 |
Molecular Formula: | C7H4FNO4 |
Molecular Weight: | 185.1094 |
MDL Number: | MFCD07368342 |
SMILES: | [O-][N+](=O)c1c(F)cccc1C(=O)O |
Complexity: | 227 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.4 |
The Journal of organic chemistry 20020222