logo
Home  > (1S,3S)-3-([(tert-Butoxy)carbonyl]amino)cyclohexane-1-carboxylic acid

AA03802

1008773-73-6 | (1S,3S)-3-([(tert-Butoxy)carbonyl]amino)cyclohexane-1-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $161.00 $113.00 -   +
250mg 95% in stock $273.00 $192.00 -   +
1g 95% in stock $657.00 $460.00 -   +
5g 95% in stock $1,955.00 $1,369.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA03802
Chemical Name: (1S,3S)-3-([(tert-Butoxy)carbonyl]amino)cyclohexane-1-carboxylic acid
CAS Number: 1008773-73-6
Molecular Formula: C12H21NO4
Molecular Weight: 243.2994
MDL Number: MFCD24471201
SMILES: O=C(OC(C)(C)C)N[C@H]1CCC[C@@H](C1)C(=O)O

 

Upstream Synthesis Route 
  • The compound (1S,3S)-3-{[(tert-butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. With its unique structure, $name$ is commonly used in the synthesis of complex molecules and pharmaceuticals due to its chirality and functional groups.One of the key applications of $name$ in chemical synthesis is as a precursor for the synthesis of peptidomimetics and peptide-based drugs. By selectively modifying the functional groups of $name$, chemists can tailor its reactivity to facilitate the formation of desired peptide bonds and structures. Additionally, the chiral nature of $name$ allows for the creation of enantiopure compounds, which is essential in drug development to ensure efficacy and reduce side effects.Furthermore, the tert-butoxy carbonyl (Boc) protecting group in $name$ serves as a temporary shield for the amine group during various chemical reactions, enabling selective functionalization of other parts of the molecule. This protective group can be easily removed under mild conditions, making it an ideal tool for controlling the reactivity of $name$ in multi-step synthesis processes.In summary, the versatile nature of (1S,3S)-3-{[(tert-butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid makes it a valuable asset in chemical synthesis for the construction of diverse organic molecules, especially in the development of novel pharmaceuticals and bioactive compounds.
FEATURED PRODUCTS