logo
Home  > Ethanaminium, 2,2'-[(1,8-dioxo-1,8-octanediyl)bis(oxy)]bis[N,N,N-trimethyl-, dichloride (9CI)

AA03981

100930-12-9 | Ethanaminium, 2,2'-[(1,8-dioxo-1,8-octanediyl)bis(oxy)]bis[N,N,N-trimethyl-, dichloride (9CI)

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $69.00 $49.00 -   +
5g 98% in stock $234.00 $164.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA03981
Chemical Name: Ethanaminium, 2,2'-[(1,8-dioxo-1,8-octanediyl)bis(oxy)]bis[N,N,N-trimethyl-, dichloride (9CI)
CAS Number: 100930-12-9
Molecular Formula: C18H38Cl2N2O4
Molecular Weight: 417.4113
MDL Number: MFCD00011784
SMILES: O=C(OCC[N+](C)(C)C)CCCCCCC(=O)OCC[N+](C)(C)C.[Cl-].[Cl-]

 

Upstream Synthesis Route 
  • Ethanaminium, 2,2'-[(1,8-dioxo-1,8-octanediyl)bis(oxy)]bis[N,N,N-trimethyl-, dichloride (9CI) is a versatile compound widely utilized in chemical synthesis processes. In the realm of chemistry, this compound serves as an important reagent for the formation of complex organic molecules through a variety of reactions.Its unique chemical structure enables it to participate in reactions that involve the formation of bonds between different functional groups, facilitating the synthesis of intricate molecular structures. This compound is particularly valued in organic synthesis for its ability to catalyze reactions that lead to the creation of novel compounds with desired properties.Moreover, Ethanaminium, 2,2'-[(1,8-dioxo-1,8-octanediyl)bis(oxy)]bis[N,N,N-trimethyl-, dichloride (9CI) plays a crucial role in the development of pharmaceuticals, agrochemicals, and materials science. Its applications extend to the synthesis of various intermediates that are vital in the production of fine chemicals, making it an indispensable tool for scientists and researchers in the field of chemical synthesis.
FEATURED PRODUCTS