AA05216
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $11.00 | $8.00 | - + | |
5g | 95% | in stock | $34.00 | $24.00 | - + | |
10g | 95% | in stock | $50.00 | $35.00 | - + | |
25g | 95% | in stock | $119.00 | $84.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05216 |
Chemical Name: | 4-(Chlorosulfonyl)benzoic acid |
CAS Number: | 10130-89-9 |
Molecular Formula: | C7H5ClO4S |
Molecular Weight: | 220.6302 |
MDL Number: | MFCD00007448 |
SMILES: | OC(=O)c1ccc(cc1)S(=O)(=O)Cl |
Complexity: | 284 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.5 |
Journal of biological inorganic chemistry : JBIC : a publication of the Society of Biological Inorganic Chemistry 20110201
Bioorganic & medicinal chemistry letters 20030901