AB46794
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $9.00 | $7.00 | - + | |
10g | 98% | in stock | $16.00 | $12.00 | - + | |
25g | 98% | in stock | $29.00 | $21.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46794 |
Chemical Name: | O-(4-Nitrobenzoyl)hydroxylamine |
CAS Number: | 35657-36-4 |
Molecular Formula: | C7H6N2O4 |
Molecular Weight: | 182.1335 |
MDL Number: | MFCD11976095 |
SMILES: | NOC(=O)c1ccc(cc1)[N+](=O)[O-] |
Complexity: | 205 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.2 |
O-(4-Nitrobenzoyl)hydroxylamine is a valuable compound commonly used in chemical synthesis as a versatile building block with various applications. In organic synthesis, it serves as a key intermediate for the preparation of diverse organic compounds. Due to its reactivity and unique chemical properties, O-(4-Nitrobenzoyl)hydroxylamine is often utilized in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its ability to undergo selective reactions makes it a valuable tool in the creation of complex organic molecules with precise control over functional group transformations. Additionally, O-(4-Nitrobenzoyl)hydroxylamine plays a crucial role in the development of new materials and biochemical research, highlighting its significance as a staple reagent in the field of chemistry.
The Journal of organic chemistry 20050805
The Journal of organic chemistry 20020823